C20H32ClN3O2 — CID 120886231
N-[2-[2-aminoethyl(2-phenylethyl)amino]-2-oxoethyl]-2-cyclohexylacetamide;hydrochloride (PubChem CID 120886231) has the molecular formula C20H32ClN3O2 and a molecular weight of 381.95 g/mol. Its IUPAC name is N-[2-[2-aminoethyl(2-phenylethyl)amino]-2-oxoethyl]-2-cyclohexylacetamide;hydrochloride.
| Compound Name | N-[2-[2-aminoethyl(2-phenylethyl)amino]-2-oxoethyl]-2-cyclohexylacetamide;hydrochloride |
|---|---|
| PubChem CID | 120886231 |
| Molecular Formula | C20H32ClN3O2 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[2-[2-aminoethyl(2-phenylethyl)amino]-2-oxoethyl]-2-cyclohexylacetamide;hydrochloride |
| SMILES | Cl.NCCN(CCc1ccccc1)C(=O)CNC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C20H31N3O2.ClH/c21-12-14-23(13-11-17-7-3-1-4-8-17)20(25)16-22-19(24)15-18-9-5-2-6-10-18;/h1,3-4,7-8,18H,2,5-6,9-16,21H2,(H,22,24);1H |
| InChIKey | QYONBBGMFQNYAO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |