C25H35ClN2O — CID 11517237
2-[4-(dimethylamino)-4-phenylcyclohexyl]-N-(3-phenylpropyl)acetamide;hydrochloride (PubChem CID 11517237) has the molecular formula C25H35ClN2O and a molecular weight of 415.02 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-4-phenylcyclohexyl]-N-(3-phenylpropyl)acetamide;hydrochloride.
| Compound Name | 2-[4-(dimethylamino)-4-phenylcyclohexyl]-N-(3-phenylpropyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 11517237 |
| Molecular Formula | C25H35ClN2O |
| Molecular Weight | 415.02 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 2-[4-(dimethylamino)-4-phenylcyclohexyl]-N-(3-phenylpropyl)acetamide;hydrochloride |
| SMILES | CN(C)C1(c2ccccc2)CCC(CC(=O)NCCCc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C25H34N2O.ClH/c1-27(2)25(23-13-7-4-8-14-23)17-15-22(16-18-25)20-24(28)26-19-9-12-21-10-5-3-6-11-21;/h3-8,10-11,13-14,22H,9,12,15-20H2,1-2H3,(H,26,28);1H |
| InChIKey | JKHUAAVDCKVKTP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.02 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|