C16H21N3O3 — CID 74925241
2-(4-methyl-2,6-dioxo-1,3-diazinan-5-yl)-N-(3-phenylpropyl)acetamide (PubChem CID 74925241) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-(4-methyl-2,6-dioxo-1,3-diazinan-5-yl)-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(4-methyl-2,6-dioxo-1,3-diazinan-5-yl)-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 74925241 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-(4-methyl-2,6-dioxo-1,3-diazinan-5-yl)-N-(3-phenylpropyl)acetamide |
| SMILES | CC1NC(=O)NC(=O)C1CC(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C16H21N3O3/c1-11-13(15(21)19-16(22)18-11)10-14(20)17-9-5-8-12-6-3-2-4-7-12/h2-4,6-7,11,13H,5,8-10H2,1H3,(H,17,20)(H2,18,19,21,22) |
| InChIKey | DITIVORUMWQXCB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|