C19H22N4O4 — CID 42649517
2-(1,3-dimethyl-2,4,6-trioxo-5,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)-N-(3-phenylpropyl)acetamide (PubChem CID 42649517) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,4,6-trioxo-5,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,4,6-trioxo-5,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 42649517 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-(1,3-dimethyl-2,4,6-trioxo-5,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)-N-(3-phenylpropyl)acetamide |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)C(CC(=O)NCCCc1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C19H22N4O4/c1-22-16-15(18(26)23(2)19(22)27)13(17(25)21-16)11-14(24)20-10-6-9-12-7-4-3-5-8-12/h3-5,7-8,13H,6,9-11H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | IDMBLMXPBPFRJZ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|