C19H24N2O — CID 78787240
2-[benzyl(methyl)amino]-N-(3-phenylpropyl)acetamide (PubChem CID 78787240) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[benzyl(methyl)amino]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 78787240 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2-[benzyl(methyl)amino]-N-(3-phenylpropyl)acetamide |
| SMILES | CN(CC(=O)NCCCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2O/c1-21(15-18-11-6-3-7-12-18)16-19(22)20-14-8-13-17-9-4-2-5-10-17/h2-7,9-12H,8,13-16H2,1H3,(H,20,22) |
| InChIKey | ORCSABNKOYXWEK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|