C22H30N2O3 — CID 8680286
2-[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]-N-(3-phenylpropyl)acetamide (PubChem CID 8680286) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 8680286 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 2-[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]-N-(3-phenylpropyl)acetamide |
| SMILES | COc1cc(C)c(CN(C)CC(=O)NCCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C22H30N2O3/c1-17-13-20(26-3)21(27-4)14-19(17)15-24(2)16-22(25)23-12-8-11-18-9-6-5-7-10-18/h5-7,9-10,13-14H,8,11-12,15-16H2,1-4H3,(H,23,25) |
| InChIKey | ZCHDJZNCYFGXQB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|