C21H26N2O4 — CID 108949889
N'-[(3,4-dimethoxyphenyl)methyl]-N-(3-phenylpropyl)propanediamide (PubChem CID 108949889) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N'-[(3,4-dimethoxyphenyl)methyl]-N-(3-phenylpropyl)propanediamide.
| Compound Name | N'-[(3,4-dimethoxyphenyl)methyl]-N-(3-phenylpropyl)propanediamide |
|---|---|
| PubChem CID | 108949889 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N'-[(3,4-dimethoxyphenyl)methyl]-N-(3-phenylpropyl)propanediamide |
| SMILES | COc1ccc(CNC(=O)CC(=O)NCCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C21H26N2O4/c1-26-18-11-10-17(13-19(18)27-2)15-23-21(25)14-20(24)22-12-6-9-16-7-4-3-5-8-16/h3-5,7-8,10-11,13H,6,9,12,14-15H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | ZKCMTESMDACPRG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|