C22H29N3O2 — CID 40717867
2-[[2-(2,3-dimethylanilino)-2-oxoethyl]-methylamino]-N-(3-phenylpropyl)acetamide (PubChem CID 40717867) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-[[2-(2,3-dimethylanilino)-2-oxoethyl]-methylamino]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[[2-(2,3-dimethylanilino)-2-oxoethyl]-methylamino]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 40717867 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 2-[[2-(2,3-dimethylanilino)-2-oxoethyl]-methylamino]-N-(3-phenylpropyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN(C)CC(=O)NCCCc2ccccc2)c1C |
| InChI | InChI=1S/C22H29N3O2/c1-17-9-7-13-20(18(17)2)24-22(27)16-25(3)15-21(26)23-14-8-12-19-10-5-4-6-11-19/h4-7,9-11,13H,8,12,14-16H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | FUWKJNUTLTZGGV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|