C17H22NO3- — CID 2165135
trans-(1S,2S)-2-(3-phenylpropylcarbamoyl)cyclohexane-1-carboxylate (PubChem CID 2165135) has the molecular formula C17H22NO3- and a molecular weight of 288.37 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-phenylpropylcarbamoyl)cyclohexane-1-carboxylate.
| Compound Name | trans-(1S,2S)-2-(3-phenylpropylcarbamoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 2165135 |
| Molecular Formula | C17H22NO3- |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | trans-(1S,2S)-2-(3-phenylpropylcarbamoyl)cyclohexane-1-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCC[C@@H]1C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c19-16(14-10-4-5-11-15(14)17(20)21)18-12-6-9-13-7-2-1-3-8-13/h1-3,7-8,14-15H,4-6,9-12H2,(H,18,19)(H,20,21)/p-1/t14-,15-/m0/s1 |
| InChIKey | OTOAONYPFKALKV-GJZGRUSLSA-M |
| XLogP | 1.29 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|