C25H29NO3 — CID 58648558
(1R)-2-(2-oxo-2-phenylacetyl)-N-(4-phenylbutyl)cyclohexane-1-carboxamide (PubChem CID 58648558) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is (1R)-2-(2-oxo-2-phenylacetyl)-N-(4-phenylbutyl)cyclohexane-1-carboxamide.
| Compound Name | (1R)-2-(2-oxo-2-phenylacetyl)-N-(4-phenylbutyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58648558 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (1R)-2-(2-oxo-2-phenylacetyl)-N-(4-phenylbutyl)cyclohexane-1-carboxamide |
| SMILES | O=C(C(=O)C1CCCC[C@H]1C(=O)NCCCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29NO3/c27-23(20-14-5-2-6-15-20)24(28)21-16-7-8-17-22(21)25(29)26-18-10-9-13-19-11-3-1-4-12-19/h1-6,11-12,14-15,21-22H,7-10,13,16-18H2,(H,26,29)/t21?,22-/m1/s1 |
| InChIKey | GNZLQIOYVARLOZ-FOIFJWKZSA-N |
| XLogP | 4.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|