C24H30N2O3 — CID 59893762
benzyl (2S)-2-(4-phenylbutylcarbamoyl)piperidine-1-carboxylate (PubChem CID 59893762) has the molecular formula C24H30N2O3 and a molecular weight of 394.51 g/mol. Its IUPAC name is benzyl (2S)-2-(4-phenylbutylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-(4-phenylbutylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59893762 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | benzyl (2S)-2-(4-phenylbutylcarbamoyl)piperidine-1-carboxylate |
| SMILES | O=C(NCCCCc1ccccc1)[C@@H]1CCCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H30N2O3/c27-23(25-17-9-7-13-20-11-3-1-4-12-20)22-16-8-10-18-26(22)24(28)29-19-21-14-5-2-6-15-21/h1-6,11-12,14-15,22H,7-10,13,16-19H2,(H,25,27)/t22-/m0/s1 |
| InChIKey | AWLWVHJGWNKBKP-QFIPXVFZSA-N |
| XLogP | 4.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|