C14H19N3O3 — CID 90822117
benzyl (2S)-2-(aminomethylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 90822117) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is benzyl (2S)-2-(aminomethylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-(aminomethylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90822117 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | benzyl (2S)-2-(aminomethylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | NCNC(=O)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H19N3O3/c15-10-16-13(18)12-7-4-8-17(12)14(19)20-9-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10,15H2,(H,16,18)/t12-/m0/s1 |
| InChIKey | XBYUMIPAYCIBGX-LBPRGKRZSA-N |
| XLogP | 0.82 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|