C19H19NO3 — CID 110357682
benzyl 2-benzoylpyrrolidine-1-carboxylate (PubChem CID 110357682) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is benzyl 2-benzoylpyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-benzoylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 110357682 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | benzyl 2-benzoylpyrrolidine-1-carboxylate |
| SMILES | O=C(c1ccccc1)C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c21-18(16-10-5-2-6-11-16)17-12-7-13-20(17)19(22)23-14-15-8-3-1-4-9-15/h1-6,8-11,17H,7,12-14H2 |
| InChIKey | ZOJFSHOVLMZVTA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |