C13H18ClN3O2 — CID 135905283
[amino-(1-phenylmethoxycarbonylpyrrolidin-2-yl)methylidene]azanium chloride (PubChem CID 135905283) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is [amino-(1-phenylmethoxycarbonylpyrrolidin-2-yl)methylidene]azanium chloride.
| Compound Name | [amino-(1-phenylmethoxycarbonylpyrrolidin-2-yl)methylidene]azanium chloride |
|---|---|
| PubChem CID | 135905283 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | [amino-(1-phenylmethoxycarbonylpyrrolidin-2-yl)methylidene]azanium chloride |
| SMILES | NC(=[NH2+])C1CCCN1C(=O)OCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C13H17N3O2.ClH/c14-12(15)11-7-4-8-16(11)13(17)18-9-10-5-2-1-3-6-10;/h1-3,5-6,11H,4,7-9H2,(H3,14,15);1H |
| InChIKey | NDJNTNSRKAEYGT-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|