C17H20N2O5 — CID 14499798
1-[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]azetidine-2-carboxylic acid (PubChem CID 14499798) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]azetidine-2-carboxylic acid.
| Compound Name | 1-[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14499798 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]azetidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCN1C(=O)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H20N2O5/c20-15(18-10-8-14(18)16(21)22)13-7-4-9-19(13)17(23)24-11-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11H2,(H,21,22)/t13-,14?/m0/s1 |
| InChIKey | RVWBGKFTLYQKSB-LSLKUGRBSA-N |
| XLogP | 1.47 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |