C17H20N2O7 — CID 70459908
1-hydroxypyrrolidine-2,5-dione;(2R)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 70459908) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;(2R)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;(2R)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70459908 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;(2R)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1C(=O)OCc1ccccc1.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C13H15NO4.C4H5NO3/c15-12(16)11-7-4-8-14(11)13(17)18-9-10-5-2-1-3-6-10;6-3-1-2-4(7)5(3)8/h1-3,5-6,11H,4,7-9H2,(H,15,16);8H,1-2H2/t11-;/m1./s1 |
| InChIKey | LHODKVKYMAHRBQ-RFVHGSKJSA-N |
| XLogP | 1.40 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|