C21H20N2O3 — CID 21304756
benzyl (2S)-2-(1H-indole-6-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 21304756) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is benzyl (2S)-2-(1H-indole-6-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-(1H-indole-6-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 21304756 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | benzyl (2S)-2-(1H-indole-6-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | O=C(c1ccc2cc[nH]c2c1)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H20N2O3/c24-20(17-9-8-16-10-11-22-18(16)13-17)19-7-4-12-23(19)21(25)26-14-15-5-2-1-3-6-15/h1-3,5-6,8-11,13,19,22H,4,7,12,14H2/t19-/m0/s1 |
| InChIKey | LZQJLLODUZNSIT-IBGZPJMESA-N |
| XLogP | 4.15 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |