C27H26N4O3 — CID 69026310
benzyl 2-[[3-amino-5-(1H-indol-5-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 69026310) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is benzyl 2-[[3-amino-5-(1H-indol-5-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[[3-amino-5-(1H-indol-5-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69026310 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | benzyl 2-[[3-amino-5-(1H-indol-5-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Nc1cc(NC(=O)C2CCCN2C(=O)OCc2ccccc2)cc(-c2ccc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C27H26N4O3/c28-22-14-21(19-8-9-24-20(13-19)10-11-29-24)15-23(16-22)30-26(32)25-7-4-12-31(25)27(33)34-17-18-5-2-1-3-6-18/h1-3,5-6,8-11,13-16,25,29H,4,7,12,17,28H2,(H,30,32) |
| InChIKey | MXWJXKVNKZOIOD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|