C26H26N2O4 — CID 23582416
benzyl (2S)-2-[[3-(3-methoxyphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 23582416) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is benzyl (2S)-2-[[3-(3-methoxyphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[3-(3-methoxyphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23582416 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | benzyl (2S)-2-[[3-(3-methoxyphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COc1cccc(-c2cccc(NC(=O)[C@@H]3CCCN3C(=O)OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-31-23-13-6-11-21(17-23)20-10-5-12-22(16-20)27-25(29)24-14-7-15-28(24)26(30)32-18-19-8-3-2-4-9-19/h2-6,8-13,16-17,24H,7,14-15,18H2,1H3,(H,27,29)/t24-/m0/s1 |
| InChIKey | GQRLFIVAULPAKT-DEOSSOPVSA-N |
| XLogP | 5.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |