C27H28N2O5 — CID 23582415
benzyl (2S)-2-[[4-(2,5-dimethoxyphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 23582415) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is benzyl (2S)-2-[[4-(2,5-dimethoxyphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[4-(2,5-dimethoxyphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23582415 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | benzyl (2S)-2-[[4-(2,5-dimethoxyphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(OC)c(-c2ccc(NC(=O)[C@@H]3CCCN3C(=O)OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H28N2O5/c1-32-22-14-15-25(33-2)23(17-22)20-10-12-21(13-11-20)28-26(30)24-9-6-16-29(24)27(31)34-18-19-7-4-3-5-8-19/h3-5,7-8,10-15,17,24H,6,9,16,18H2,1-2H3,(H,28,30)/t24-/m0/s1 |
| InChIKey | ZUYNLMYBKVYTLL-DEOSSOPVSA-N |
| XLogP | 5.11 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |