C26H26N2O5S — CID 23582881
benzyl (2S)-2-[[3-(4-methylsulfonylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 23582881) has the molecular formula C26H26N2O5S and a molecular weight of 478.57 g/mol. Its IUPAC name is benzyl (2S)-2-[[3-(4-methylsulfonylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[3-(4-methylsulfonylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23582881 |
| Molecular Formula | C26H26N2O5S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | benzyl (2S)-2-[[3-(4-methylsulfonylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CS(=O)(=O)c1ccc(-c2cccc(NC(=O)[C@@H]3CCCN3C(=O)OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H26N2O5S/c1-34(31,32)23-14-12-20(13-15-23)21-9-5-10-22(17-21)27-25(29)24-11-6-16-28(24)26(30)33-18-19-7-3-2-4-8-19/h2-5,7-10,12-15,17,24H,6,11,16,18H2,1H3,(H,27,29)/t24-/m0/s1 |
| InChIKey | IRHYTXHFBQXTTI-DEOSSOPVSA-N |
| XLogP | 4.50 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |