C19H20N2O4 — CID 84577175
benzyl 2-[(4-hydroxyphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 84577175) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is benzyl 2-[(4-hydroxyphenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[(4-hydroxyphenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 84577175 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | benzyl 2-[(4-hydroxyphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1ccc(O)cc1)C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c22-16-10-8-15(9-11-16)20-18(23)17-7-4-12-21(17)19(24)25-13-14-5-2-1-3-6-14/h1-3,5-6,8-11,17,22H,4,7,12-13H2,(H,20,23) |
| InChIKey | DCWNOQICKWQOMP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|