C16H20N2O3 — CID 84576697
benzyl 2-(prop-2-enylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 84576697) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is benzyl 2-(prop-2-enylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-(prop-2-enylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 84576697 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | benzyl 2-(prop-2-enylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCNC(=O)C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H20N2O3/c1-2-10-17-15(19)14-9-6-11-18(14)16(20)21-12-13-7-4-3-5-8-13/h2-5,7-8,14H,1,6,9-12H2,(H,17,19) |
| InChIKey | WTPUKFUUHSPWPO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|