C20H31NO4 — CID 143105082
1-O-benzyl 2-O-methyl pyrrolidine-1,2-dicarboxylate;ethane;2-methylprop-1-ene (PubChem CID 143105082) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl pyrrolidine-1,2-dicarboxylate;ethane;2-methylprop-1-ene.
| Compound Name | 1-O-benzyl 2-O-methyl pyrrolidine-1,2-dicarboxylate;ethane;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143105082 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 1-O-benzyl 2-O-methyl pyrrolidine-1,2-dicarboxylate;ethane;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC.COC(=O)C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17NO4.C4H8.C2H6/c1-18-13(16)12-8-5-9-15(12)14(17)19-10-11-6-3-2-4-7-11;1-4(2)3;1-2/h2-4,6-7,12H,5,8-10H2,1H3;1H2,2-3H3;1-2H3 |
| InChIKey | UZVIIQKVPSCNFJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|