C26H24N2O5 — CID 23582878
benzyl (2S)-2-[[3-(1,3-benzodioxol-5-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 23582878) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is benzyl (2S)-2-[[3-(1,3-benzodioxol-5-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[3-(1,3-benzodioxol-5-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23582878 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | benzyl (2S)-2-[[3-(1,3-benzodioxol-5-yl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1cccc(-c2ccc3c(c2)OCO3)c1)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H24N2O5/c29-25(22-10-5-13-28(22)26(30)31-16-18-6-2-1-3-7-18)27-21-9-4-8-19(14-21)20-11-12-23-24(15-20)33-17-32-23/h1-4,6-9,11-12,14-15,22H,5,10,13,16-17H2,(H,27,29)/t22-/m0/s1 |
| InChIKey | JAPKOQJNVIXTOI-QFIPXVFZSA-N |
| XLogP | 4.82 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |