C20H21N3O4 — CID 1468785
(2R)-2-N-(1,3-benzodioxol-5-yl)-1-N-benzylpyrrolidine-1,2-dicarboxamide (PubChem CID 1468785) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (2R)-2-N-(1,3-benzodioxol-5-yl)-1-N-benzylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-2-N-(1,3-benzodioxol-5-yl)-1-N-benzylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1468785 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (2R)-2-N-(1,3-benzodioxol-5-yl)-1-N-benzylpyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)[C@H]1CCCN1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H21N3O4/c24-19(22-15-8-9-17-18(11-15)27-13-26-17)16-7-4-10-23(16)20(25)21-12-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2,(H,21,25)(H,22,24)/t16-/m1/s1 |
| InChIKey | VJDNQQROUDYNPW-MRXNPFEDSA-N |
| XLogP | 2.73 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |