C21H25N3O4 — CID 3219752
1-N-benzyl-2-N-(3,5-dimethoxyphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 3219752) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-N-benzyl-2-N-(3,5-dimethoxyphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 1-N-benzyl-2-N-(3,5-dimethoxyphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 3219752 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-N-benzyl-2-N-(3,5-dimethoxyphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | COc1cc(NC(=O)C2CCCN2C(=O)NCc2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C21H25N3O4/c1-27-17-11-16(12-18(13-17)28-2)23-20(25)19-9-6-10-24(19)21(26)22-14-15-7-4-3-5-8-15/h3-5,7-8,11-13,19H,6,9-10,14H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | JQZGJSAEBIFQGX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |