C21H27N3O4 — CID 11811114
benzyl (2S)-2-[(4-isocyanatocyclohexyl)methylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 11811114) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is benzyl (2S)-2-[(4-isocyanatocyclohexyl)methylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[(4-isocyanatocyclohexyl)methylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11811114 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | benzyl (2S)-2-[(4-isocyanatocyclohexyl)methylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C=NC1CCC(CNC(=O)[C@@H]2CCCN2C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H27N3O4/c25-15-23-18-10-8-16(9-11-18)13-22-20(26)19-7-4-12-24(19)21(27)28-14-17-5-2-1-3-6-17/h1-3,5-6,16,18-19H,4,7-14H2,(H,22,26)/t16?,18?,19-/m0/s1 |
| InChIKey | YMXNPQSXNZBXFX-KVZIAJEVSA-N |
| XLogP | 2.80 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|