C21H27N5O4 — CID 11732411
benzyl (2S)-2-[(4-carbonazidoylcyclohexyl)methylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 11732411) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is benzyl (2S)-2-[(4-carbonazidoylcyclohexyl)methylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[(4-carbonazidoylcyclohexyl)methylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11732411 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | benzyl (2S)-2-[(4-carbonazidoylcyclohexyl)methylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | [N-]=[N+]=NC(=O)C1CCC(CNC(=O)[C@@H]2CCCN2C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H27N5O4/c22-25-24-19(27)17-10-8-15(9-11-17)13-23-20(28)18-7-4-12-26(18)21(29)30-14-16-5-2-1-3-6-16/h1-3,5-6,15,17-18H,4,7-14H2,(H,23,28)/t15?,17?,18-/m0/s1 |
| InChIKey | IGGHNJQGPJBSET-VJFUWPCTSA-N |
| XLogP | 3.55 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|