C18H27N2O5PS — CID 11189178
[2-oxo-2-[(2S)-2-(3-phenylpropylcarbamoyl)piperidin-1-yl]ethyl]sulfanylmethylphosphonic acid (PubChem CID 11189178) has the molecular formula C18H27N2O5PS and a molecular weight of 414.46 g/mol. Its IUPAC name is [2-oxo-2-[(2S)-2-(3-phenylpropylcarbamoyl)piperidin-1-yl]ethyl]sulfanylmethylphosphonic acid.
| Compound Name | [2-oxo-2-[(2S)-2-(3-phenylpropylcarbamoyl)piperidin-1-yl]ethyl]sulfanylmethylphosphonic acid |
|---|---|
| PubChem CID | 11189178 |
| Molecular Formula | C18H27N2O5PS |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [2-oxo-2-[(2S)-2-(3-phenylpropylcarbamoyl)piperidin-1-yl]ethyl]sulfanylmethylphosphonic acid |
| SMILES | O=C(NCCCc1ccccc1)[C@@H]1CCCCN1C(=O)CSCP(=O)(O)O |
| InChI | InChI=1S/C18H27N2O5PS/c21-17(13-27-14-26(23,24)25)20-12-5-4-10-16(20)18(22)19-11-6-9-15-7-2-1-3-8-15/h1-3,7-8,16H,4-6,9-14H2,(H,19,22)(H2,23,24,25)/t16-/m0/s1 |
| InChIKey | YFQPRRPQIZINLY-INIZCTEOSA-N |
| XLogP | 1.98 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|