C20H28N2O2 — CID 15080758
4-phenyl-1-[2-(pyrrolidine-1-carbonyl)piperidin-1-yl]butan-1-one (PubChem CID 15080758) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-phenyl-1-[2-(pyrrolidine-1-carbonyl)piperidin-1-yl]butan-1-one.
| Compound Name | 4-phenyl-1-[2-(pyrrolidine-1-carbonyl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 15080758 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 4-phenyl-1-[2-(pyrrolidine-1-carbonyl)piperidin-1-yl]butan-1-one |
| SMILES | O=C(C1CCCCN1C(=O)CCCc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C20H28N2O2/c23-19(13-8-11-17-9-2-1-3-10-17)22-16-5-4-12-18(22)20(24)21-14-6-7-15-21/h1-3,9-10,18H,4-8,11-16H2 |
| InChIKey | UZCWGAUYZHRAFR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |