C27H33N3O3 — CID 59940953
N-[4-oxo-4-[(2S)-2-(pyrrolidine-1-carbonyl)pyrrolidin-1-yl]butyl]-2,2-diphenylacetamide (PubChem CID 59940953) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-[4-oxo-4-[(2S)-2-(pyrrolidine-1-carbonyl)pyrrolidin-1-yl]butyl]-2,2-diphenylacetamide.
| Compound Name | N-[4-oxo-4-[(2S)-2-(pyrrolidine-1-carbonyl)pyrrolidin-1-yl]butyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 59940953 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | N-[4-oxo-4-[(2S)-2-(pyrrolidine-1-carbonyl)pyrrolidin-1-yl]butyl]-2,2-diphenylacetamide |
| SMILES | O=C(NCCCC(=O)N1CCC[C@H]1C(=O)N1CCCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33N3O3/c31-24(30-20-10-15-23(30)27(33)29-18-7-8-19-29)16-9-17-28-26(32)25(21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-6,11-14,23,25H,7-10,15-20H2,(H,28,32)/t23-/m0/s1 |
| InChIKey | QYRUWKKWAKRSRX-QHCPKHFHSA-N |
| XLogP | 3.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|