C24H30N2O2 — CID 95592208
N-[4-oxo-4-[(2S)-2-[(1R)-1-phenylpropyl]pyrrolidin-1-yl]butyl]benzamide (PubChem CID 95592208) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[4-oxo-4-[(2S)-2-[(1R)-1-phenylpropyl]pyrrolidin-1-yl]butyl]benzamide.
| Compound Name | N-[4-oxo-4-[(2S)-2-[(1R)-1-phenylpropyl]pyrrolidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 95592208 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-[4-oxo-4-[(2S)-2-[(1R)-1-phenylpropyl]pyrrolidin-1-yl]butyl]benzamide |
| SMILES | CC[C@H](c1ccccc1)[C@@H]1CCCN1C(=O)CCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O2/c1-2-21(19-11-5-3-6-12-19)22-15-10-18-26(22)23(27)16-9-17-25-24(28)20-13-7-4-8-14-20/h3-8,11-14,21-22H,2,9-10,15-18H2,1H3,(H,25,28)/t21-,22+/m1/s1 |
| InChIKey | PZHHYRCEPIUUIP-YADHBBJMSA-N |
| XLogP | 4.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|