C21H25NO2 — CID 95592187
(3-methoxyphenyl)-[(2S)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]methanone (PubChem CID 95592187) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (3-methoxyphenyl)-[(2S)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]methanone.
| Compound Name | (3-methoxyphenyl)-[(2S)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95592187 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (3-methoxyphenyl)-[(2S)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]methanone |
| SMILES | CC[C@@H](c1ccccc1)[C@@H]1CCCN1C(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C21H25NO2/c1-3-19(16-9-5-4-6-10-16)20-13-8-14-22(20)21(23)17-11-7-12-18(15-17)24-2/h4-7,9-12,15,19-20H,3,8,13-14H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | ZRJJKRIJMJWIIN-PMACEKPBSA-N |
| XLogP | 4.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |