C19H29NO3 — CID 95300829
3-(2-methoxyethoxy)-1-[(2R)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]propan-1-one (PubChem CID 95300829) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)-1-[(2R)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(2-methoxyethoxy)-1-[(2R)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95300829 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-(2-methoxyethoxy)-1-[(2R)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]propan-1-one |
| SMILES | CC[C@@H](c1ccccc1)[C@H]1CCCN1C(=O)CCOCCOC |
| InChI | InChI=1S/C19H29NO3/c1-3-17(16-8-5-4-6-9-16)18-10-7-12-20(18)19(21)11-13-23-15-14-22-2/h4-6,8-9,17-18H,3,7,10-15H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | DXMSZSVQBGTWTD-ZWKOTPCHSA-N |
| XLogP | 3.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|