C26H30N2O4 — CID 54563213
benzyl (2S)-1-[(2S)-1-(3-phenylpropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 54563213) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is benzyl (2S)-1-[(2S)-1-(3-phenylpropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[(2S)-1-(3-phenylpropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 54563213 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | benzyl (2S)-1-[(2S)-1-(3-phenylpropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C26H30N2O4/c29-24(16-15-20-9-3-1-4-10-20)27-17-7-13-22(27)25(30)28-18-8-14-23(28)26(31)32-19-21-11-5-2-6-12-21/h1-6,9-12,22-23H,7-8,13-19H2/t22-,23-/m0/s1 |
| InChIKey | ZRZQEFAMJJCKSZ-GOTSBHOMSA-N |
| XLogP | 3.34 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |