C23H35NO3 — CID 91695582
nonyl 1-(3-phenylpropanoyl)pyrrolidine-2-carboxylate (PubChem CID 91695582) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is nonyl 1-(3-phenylpropanoyl)pyrrolidine-2-carboxylate.
| Compound Name | nonyl 1-(3-phenylpropanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91695582 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | nonyl 1-(3-phenylpropanoyl)pyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCCOC(=O)C1CCCN1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C23H35NO3/c1-2-3-4-5-6-7-11-19-27-23(26)21-15-12-18-24(21)22(25)17-16-20-13-9-8-10-14-20/h8-10,13-14,21H,2-7,11-12,15-19H2,1H3 |
| InChIKey | ZGXRYWKAWPTZGH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|