C30H36N2O6 — CID 54052130
benzyl (2S)-1-[6-oxo-6-[(2S)-2-phenylmethoxycarbonylpyrrolidin-1-yl]hexanoyl]pyrrolidine-2-carboxylate (PubChem CID 54052130) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is benzyl (2S)-1-[6-oxo-6-[(2S)-2-phenylmethoxycarbonylpyrrolidin-1-yl]hexanoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[6-oxo-6-[(2S)-2-phenylmethoxycarbonylpyrrolidin-1-yl]hexanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 54052130 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | benzyl (2S)-1-[6-oxo-6-[(2S)-2-phenylmethoxycarbonylpyrrolidin-1-yl]hexanoyl]pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1CCCN1C(=O)CCCCC(=O)N1CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H36N2O6/c33-27(31-19-9-15-25(31)29(35)37-21-23-11-3-1-4-12-23)17-7-8-18-28(34)32-20-10-16-26(32)30(36)38-22-24-13-5-2-6-14-24/h1-6,11-14,25-26H,7-10,15-22H2/t25-,26-/m0/s1 |
| InChIKey | LTQAMJZIYVNFNW-UIOOFZCWSA-N |
| XLogP | 4.02 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|