C30H40N2O6 — CID 123987147
benzyl 1-[6-[2-(2-ethylidenepent-3-enoxycarbonyl)pyrrolidin-1-yl]-6-oxohexanoyl]pyrrolidine-2-carboxylate (PubChem CID 123987147) has the molecular formula C30H40N2O6 and a molecular weight of 524.66 g/mol. Its IUPAC name is benzyl 1-[6-[2-(2-ethylidenepent-3-enoxycarbonyl)pyrrolidin-1-yl]-6-oxohexanoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl 1-[6-[2-(2-ethylidenepent-3-enoxycarbonyl)pyrrolidin-1-yl]-6-oxohexanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 123987147 |
| Molecular Formula | C30H40N2O6 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | benzyl 1-[6-[2-(2-ethylidenepent-3-enoxycarbonyl)pyrrolidin-1-yl]-6-oxohexanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC=CC(=CC)COC(=O)C1CCCN1C(=O)CCCCC(=O)N1CCCC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H40N2O6/c1-3-12-23(4-2)21-37-29(35)25-15-10-19-31(25)27(33)17-8-9-18-28(34)32-20-11-16-26(32)30(36)38-22-24-13-6-5-7-14-24/h3-7,12-14,25-26H,8-11,15-22H2,1-2H3 |
| InChIKey | LKFDFSLGUHQHFS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|