About pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate
pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate (PubChem CID 91695537) has the molecular formula C18H25NO3
and a molecular weight of 303.40 g/mol. Its IUPAC name is pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate |
| PubChem CID | 91695537 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate |
| SMILES | CCCCCOC(=O)C1CCCN1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H25NO3/c1-2-3-7-13-22-18(21)16-11-8-12-19(16)17(20)14-15-9-5-4-6-10-15/h4-6,9-10,16H,2-3,7-8,11-14H2,1H3 |
| InChIKey | HTZALULWXUKBDX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate?
The IUPAC name of pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate (CID 91695537) is pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate.
What is the SMILES notation for pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate?
The canonical SMILES for pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate is CCCCCOC(=O)C1CCCN1C(=O)Cc1ccccc1.
What is the InChIKey of pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate?
The InChIKey is HTZALULWXUKBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO3/c1-2-3-7-13-22-18(21)16-11-8-12-19(16)17(20)14-15-9-5-4-6-10-15/h4-6,9-10,16H,2-3,7-8,11-14H2,1H3.
What are the key properties of pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate?
pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate has a molecular weight of 303.40 g/mol, XLogP of 2.95, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 1-(2-phenylacetyl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 91695537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).