C25H33N3O2 — CID 10136100
N-(5-aminopentyl)-1-[2-(4-phenylphenyl)acetyl]piperidine-2-carboxamide (PubChem CID 10136100) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-(5-aminopentyl)-1-[2-(4-phenylphenyl)acetyl]piperidine-2-carboxamide.
| Compound Name | N-(5-aminopentyl)-1-[2-(4-phenylphenyl)acetyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 10136100 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-(5-aminopentyl)-1-[2-(4-phenylphenyl)acetyl]piperidine-2-carboxamide |
| SMILES | NCCCCCNC(=O)C1CCCCN1C(=O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H33N3O2/c26-16-6-2-7-17-27-25(30)23-11-5-8-18-28(23)24(29)19-20-12-14-22(15-13-20)21-9-3-1-4-10-21/h1,3-4,9-10,12-15,23H,2,5-8,11,16-19,26H2,(H,27,30) |
| InChIKey | ZCYKJUAQWJRCBD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|