C20H22N2O4 — CID 136521380
N-[(3,4-dihydroxyphenyl)methyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide (PubChem CID 136521380) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[(3,4-dihydroxyphenyl)methyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[(3,4-dihydroxyphenyl)methyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 136521380 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-[(3,4-dihydroxyphenyl)methyl]-1-(2-phenylacetyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccc(O)c(O)c1)C1CCCN1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2O4/c23-17-9-8-15(11-18(17)24)13-21-20(26)16-7-4-10-22(16)19(25)12-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,16,23-24H,4,7,10,12-13H2,(H,21,26) |
| InChIKey | KNZAYRCVRCGAIF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|