C20H21N3O4 — CID 47923812
N'-(2-hydroxybenzoyl)-1-(2-phenylacetyl)pyrrolidine-2-carbohydrazide (PubChem CID 47923812) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N'-(2-hydroxybenzoyl)-1-(2-phenylacetyl)pyrrolidine-2-carbohydrazide.
| Compound Name | N'-(2-hydroxybenzoyl)-1-(2-phenylacetyl)pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 47923812 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N'-(2-hydroxybenzoyl)-1-(2-phenylacetyl)pyrrolidine-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCN1C(=O)Cc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C20H21N3O4/c24-17-11-5-4-9-15(17)19(26)21-22-20(27)16-10-6-12-23(16)18(25)13-14-7-2-1-3-8-14/h1-5,7-9,11,16,24H,6,10,12-13H2,(H,21,26)(H,22,27) |
| InChIKey | UQFZXECKGJWLDQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|