C23H27N3O3 — CID 24720617
(2R)-N-(2-benzamidoethyl)-1-(3-phenylpropanoyl)pyrrolidine-2-carboxamide (PubChem CID 24720617) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is (2R)-N-(2-benzamidoethyl)-1-(3-phenylpropanoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(2-benzamidoethyl)-1-(3-phenylpropanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24720617 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (2R)-N-(2-benzamidoethyl)-1-(3-phenylpropanoyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCNC(=O)[C@H]1CCCN1C(=O)CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O3/c27-21(14-13-18-8-3-1-4-9-18)26-17-7-12-20(26)23(29)25-16-15-24-22(28)19-10-5-2-6-11-19/h1-6,8-11,20H,7,12-17H2,(H,24,28)(H,25,29)/t20-/m1/s1 |
| InChIKey | RRMAWQSNJZKXDU-HXUWFJFHSA-N |
| XLogP | 2.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|