C21H24N4O3 — CID 60584974
N-[2-[[1-(2-phenylacetyl)pyrrolidine-2-carbonyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 60584974) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[2-[[1-(2-phenylacetyl)pyrrolidine-2-carbonyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[1-(2-phenylacetyl)pyrrolidine-2-carbonyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60584974 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[2-[[1-(2-phenylacetyl)pyrrolidine-2-carbonyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCCN1C(=O)Cc1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C21H24N4O3/c26-19(14-16-6-2-1-3-7-16)25-13-5-9-18(25)21(28)24-12-11-23-20(27)17-8-4-10-22-15-17/h1-4,6-8,10,15,18H,5,9,11-14H2,(H,23,27)(H,24,28) |
| InChIKey | IZVMKRPCBHYKQH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|