C27H33N3O3 — CID 51071444
(2S)-N-(4-benzamidocyclohexyl)-1-(3-phenylpropanoyl)pyrrolidine-2-carboxamide (PubChem CID 51071444) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is (2S)-N-(4-benzamidocyclohexyl)-1-(3-phenylpropanoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4-benzamidocyclohexyl)-1-(3-phenylpropanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 51071444 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | (2S)-N-(4-benzamidocyclohexyl)-1-(3-phenylpropanoyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CCC(NC(=O)[C@@H]2CCCN2C(=O)CCc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H33N3O3/c31-25(18-13-20-8-3-1-4-9-20)30-19-7-12-24(30)27(33)29-23-16-14-22(15-17-23)28-26(32)21-10-5-2-6-11-21/h1-6,8-11,22-24H,7,12-19H2,(H,28,32)(H,29,33)/t22?,23?,24-/m0/s1 |
| InChIKey | RHVHGQWJNPGGQC-VHYCJAOWSA-N |
| XLogP | 3.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |