C24H35N3O3 — CID 51071442
(2S)-N-(4-benzamidocyclohexyl)-1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxamide (PubChem CID 51071442) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is (2S)-N-(4-benzamidocyclohexyl)-1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4-benzamidocyclohexyl)-1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 51071442 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | (2S)-N-(4-benzamidocyclohexyl)-1-(3,3-dimethylbutanoyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)CC(=O)N1CCC[C@H]1C(=O)NC1CCC(NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H35N3O3/c1-24(2,3)16-21(28)27-15-7-10-20(27)23(30)26-19-13-11-18(12-14-19)25-22(29)17-8-5-4-6-9-17/h4-6,8-9,18-20H,7,10-16H2,1-3H3,(H,25,29)(H,26,30)/t18?,19?,20-/m0/s1 |
| InChIKey | JFQJNCXPXFTTSQ-MHJFOBGBSA-N |
| XLogP | 3.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |