C21H21Cl2N3O3 — CID 51066683
(2S)-N-(2-benzamidoethyl)-1-(3,4-dichlorobenzoyl)pyrrolidine-2-carboxamide (PubChem CID 51066683) has the molecular formula C21H21Cl2N3O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is (2S)-N-(2-benzamidoethyl)-1-(3,4-dichlorobenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(2-benzamidoethyl)-1-(3,4-dichlorobenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 51066683 |
| Molecular Formula | C21H21Cl2N3O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (2S)-N-(2-benzamidoethyl)-1-(3,4-dichlorobenzoyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCNC(=O)[C@@H]1CCCN1C(=O)c1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C21H21Cl2N3O3/c22-16-9-8-15(13-17(16)23)21(29)26-12-4-7-18(26)20(28)25-11-10-24-19(27)14-5-2-1-3-6-14/h1-3,5-6,8-9,13,18H,4,7,10-12H2,(H,24,27)(H,25,28)/t18-/m0/s1 |
| InChIKey | ZTYBWWCOVVDKRF-SFHVURJKSA-N |
| XLogP | 3.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|