C24H29N3O6 — CID 51071507
(2S)-1-(3,5-dimethoxybenzoyl)-N-[2-[(4-methoxybenzoyl)amino]ethyl]pyrrolidine-2-carboxamide (PubChem CID 51071507) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is (2S)-1-(3,5-dimethoxybenzoyl)-N-[2-[(4-methoxybenzoyl)amino]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(3,5-dimethoxybenzoyl)-N-[2-[(4-methoxybenzoyl)amino]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 51071507 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (2S)-1-(3,5-dimethoxybenzoyl)-N-[2-[(4-methoxybenzoyl)amino]ethyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)[C@@H]2CCCN2C(=O)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C24H29N3O6/c1-31-18-8-6-16(7-9-18)22(28)25-10-11-26-23(29)21-5-4-12-27(21)24(30)17-13-19(32-2)15-20(14-17)33-3/h6-9,13-15,21H,4-5,10-12H2,1-3H3,(H,25,28)(H,26,29)/t21-/m0/s1 |
| InChIKey | DZQDQKXIWJBDQB-NRFANRHFSA-N |
| XLogP | 1.86 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|