C26H33N3O4 — CID 55965832
1-[3-[(4-tert-butylbenzoyl)amino]propanoyl]-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 55965832) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 1-[3-[(4-tert-butylbenzoyl)amino]propanoyl]-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[(4-tert-butylbenzoyl)amino]propanoyl]-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55965832 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 1-[3-[(4-tert-butylbenzoyl)amino]propanoyl]-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN2C(=O)CCNC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H33N3O4/c1-26(2,3)19-9-7-18(8-10-19)24(31)27-16-15-23(30)29-17-5-6-22(29)25(32)28-20-11-13-21(33-4)14-12-20/h7-14,22H,5-6,15-17H2,1-4H3,(H,27,31)(H,28,32) |
| InChIKey | ZVIHZQNHVVIIED-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |